ChemNet > CAS > 256383-45-6 4-n-Nonylbenzeneboronic acid
256383-45-6 4-n-Nonylbenzeneboronic acid
produktnavn |
4-n-Nonylbenzeneboronic acid |
Synonymer |
4-Nonylphenylboronicacid; (4-nonylphenyl)boronic acid; 4-N-Nonylphenylboronicacid |
Molekylær Formel |
C15H25BO2 |
Molekylvekt |
248.1688 |
InChI |
InChI=1/C15H25BO2/c1-2-3-4-5-6-7-8-9-14-10-12-15(13-11-14)16(17)18/h10-13,17-18H,2-9H2,1H3 |
CAS-nummer |
256383-45-6 |
Molecular Structure |
|
Tetthet |
0.97g/cm3 |
Kokepunkt |
385.3°C at 760 mmHg |
Brytningsindeks |
1.501 |
Flammepunktet |
186.8°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|